CAS 673435-38-6 appears in our catalog under these names: (Pentamethylphenyl)methanamine hydrochloride, 95%, (Pentamethylphenyl)methanamine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
(2,3,4,5,6-pentamethylphenyl)methanamine;hydrochloride (CAS 673435-38-6) is a chemical compound with the molecular formula C12H20ClN and a molecular weight of 213.75 g/mol. IUPAC name: (2,3,4,5,6-pentamethylphenyl)methanamine;hydrochloride. InChIKey: OOMHVEJZKZGYNM-UHFFFAOYSA-N.
| Molecular formula | C12H20ClN |
|---|---|
| Molecular weight | 213.75 g/mol |
| IUPAC name | (2,3,4,5,6-pentamethylphenyl)methanamine;hydrochloride |
| InChIKey | OOMHVEJZKZGYNM-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1C)C)CN)C)C.Cl |
Computed by PubChem (NCBI)