CAS 67358-87-6 is the registry number for 8-Chloro-2,4-dimethylquinoline, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
8-chloro-2,4-dimethylquinoline (CAS 67358-87-6) is a chemical compound with the molecular formula C11H10ClN and a molecular weight of 191.65 g/mol. IUPAC name: 8-chloro-2,4-dimethylquinoline. InChIKey: WKQVVELXWGPGIY-UHFFFAOYSA-N.
| Molecular formula | C11H10ClN |
|---|---|
| Molecular weight | 191.65 g/mol |
| IUPAC name | 8-chloro-2,4-dimethylquinoline |
| InChIKey | WKQVVELXWGPGIY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=C1C=CC=C2Cl)C |
Computed by PubChem (NCBI)