CAS 6739-66-8 is the registry number for 2-Tosylacetaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4-methylphenyl)sulfonylacetaldehyde (CAS 6739-66-8) is a chemical compound with the molecular formula C9H10O3S and a molecular weight of 198.24 g/mol. IUPAC name: 2-(4-methylphenyl)sulfonylacetaldehyde. InChIKey: ZUXWOUUBOVROPH-UHFFFAOYSA-N.
| Molecular formula | C9H10O3S |
|---|---|
| Molecular weight | 198.24 g/mol |
| IUPAC name | 2-(4-methylphenyl)sulfonylacetaldehyde |
| InChIKey | ZUXWOUUBOVROPH-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)CC=O |
Computed by PubChem (NCBI)