Products 6747-15-5
CAS 6747-15-5 appears in our catalog under these names: D,L-3-Indolylglycine, >95% (HPLC), DL-3-Indolylglycine, D,L-3-Indolylglycine, H-DL-2-(Indole-3-yl)-Gly-OH 95%, D，L-3-Indolylglycine, 95%, 95%. Offered by: TRC, TargetMol, Biosynth, Ambeed, Chemat. Available pack sizes: 100mg, 5mg, 10mg, 0,1g, 0,25g, 0,5g, 1g, 250mg.
(2R)-2-amino-2-(1H-indol-3-yl)acetic acid (CAS 6747-15-5) is a chemical compound with the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. IUPAC name: (2R)-2-amino-2-(1H-indol-3-yl)acetic acid. InChIKey: AIZGBPJAKQNCSD-SECBINFHSA-N.
| Molecular formula | C10H10N2O2 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | (2R)-2-amino-2-(1H-indol-3-yl)acetic acid |
| InChIKey | AIZGBPJAKQNCSD-SECBINFHSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)[C@H](C(=O)O)N |
Computed by PubChem (NCBI)