Products 67470-99-9
CAS 67470-99-9 appears in our catalog under these names: Benzo(b)(1，4)dioxine–6–carboxylic acid, Benzo[b][1,4]dioxine-6-carboxylic acid, 97%, 97%, BENZO[B][1,4]DIOXINE-6-CARBOXYLIC ACID, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.
1,4-benzodioxine-6-carboxylic acid (CAS 67470-99-9) is a chemical compound with the molecular formula C9H6O4 and a molecular weight of 178.14 g/mol. IUPAC name: 1,4-benzodioxine-6-carboxylic acid. InChIKey: NQERPEZSJJWHGE-UHFFFAOYSA-N.
| Molecular formula | C9H6O4 |
|---|---|
| Molecular weight | 178.14 g/mol |
| IUPAC name | 1,4-benzodioxine-6-carboxylic acid |
| InChIKey | NQERPEZSJJWHGE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)OC=CO2 |
Computed by PubChem (NCBI)