CAS 6761-86-0 is the registry number for (5,6-dimethyl-1H-1,3-benzodiazol-2-yl)methanol, 97%, 97%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g.
(5,6-dimethyl-1H-benzimidazol-2-yl)methanol (CAS 6761-86-0) is a chemical compound with the molecular formula C10H12N2O and a molecular weight of 176.21 g/mol. IUPAC name: (5,6-dimethyl-1H-benzimidazol-2-yl)methanol. InChIKey: NLTYZPBQHXXZGL-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | (5,6-dimethyl-1H-benzimidazol-2-yl)methanol |
| InChIKey | NLTYZPBQHXXZGL-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1C)N=C(N2)CO |
Computed by PubChem (NCBI)