Products 676260-66-5
CAS 676260-66-5 appears in our catalog under these names: Atorvastatin Impurity 160, Atorvastatin Impurity 133. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
Methyl 2-[(4S,6S)-6-(2-aminoethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate (CAS 676260-66-5) is a chemical compound with the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. IUPAC name: methyl 2-[(4S,6S)-6-(2-aminoethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate. InChIKey: UKPLIUIGZLPIEF-IUCAKERBSA-N.
| Molecular formula | C11H21NO4 |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | methyl 2-[(4S,6S)-6-(2-aminoethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
| InChIKey | UKPLIUIGZLPIEF-IUCAKERBSA-N |
| SMILES | CC1(O[C@H](C[C@H](O1)CC(=O)OC)CCN)C |
Computed by PubChem (NCBI)