CAS 676487-35-7 appears in our catalog under these names: (Rac)-Taltobulin intermediate-1, 98%, 2–((tert–Butoxycarbonyl)(methyl)amino)–3–methyl–3–phenylbutanoic acid, 2-((Tert-Butoxycarbonyl)(Methyl)Amino)-3-Methyl-3-Phenylbutanoic Acid, 98%, 98%, (Rac)-Taltobulin intermediate-1, 99.11%, 2-((tert-Butoxycarbonyl)(methyl)amino)-3-methyl-3-phenylbutanoic acid, 98%. Offered by: AmBeed, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 50mg, 100 mg, 50 mg, 250 mg, 10mM/1mL.
3-methyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-phenylbutanoic acid (CAS 676487-35-7) is a chemical compound with the molecular formula C17H25NO4 and a molecular weight of 307.4 g/mol. IUPAC name: 3-methyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-phenylbutanoic acid. InChIKey: ZWQAFCGLXUTMKH-UHFFFAOYSA-N.
| Molecular formula | C17H25NO4 |
|---|---|
| Molecular weight | 307.4 g/mol |
| IUPAC name | 3-methyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-phenylbutanoic acid |
| InChIKey | ZWQAFCGLXUTMKH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)C(C(=O)O)C(C)(C)C1=CC=CC=C1 |
Computed by PubChem (NCBI)