Products 676560-01-3
CAS 676560-01-3 appears in our catalog under these names: tert-Butyl 6-fluoronicotinate, 98%, tert–Butyl 6–fluoronicotinate, 6-Fluoronicotinic acid tert-butyl ester, tert-Butyl 6-fluoronicotinate 95%, tert-butyl 6-fluoronicotinate, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 10g, 1g, 5g, 250mg, 100mg, 25g, 500mg, 2.5g.
Tert-butyl 6-fluoropyridine-3-carboxylate (CAS 676560-01-3) is a chemical compound with the molecular formula C10H12FNO2 and a molecular weight of 197.21 g/mol. IUPAC name: tert-butyl 6-fluoropyridine-3-carboxylate. InChIKey: RZWMKWGTXCIWLV-UHFFFAOYSA-N.
| Molecular formula | C10H12FNO2 |
|---|---|
| Molecular weight | 197.21 g/mol |
| IUPAC name | tert-butyl 6-fluoropyridine-3-carboxylate |
| InChIKey | RZWMKWGTXCIWLV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CN=C(C=C1)F |
Computed by PubChem (NCBI)