CAS 676629-90-6 appears in our catalog under these names: (S)-Boc-2-amino-3,3-dimethyl-pent-4-enoic acid, 95%, 2-(Boc-amino)-3,3-diMe-pent-4-enoic acid (S), Boc-3-Vinyl-Val-OH 97%, (S)-2-((tert-Butoxycarbonyl)amino)-3,3-dimethylpent-4-enoic acid, 97%, 97%, (S)-Boc-2-amino-3,3-dimethyl-pent-4-enoic acid, 97%. Offered by: Combi-blocks, Iris Biotech, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g, 50mg.
(2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoic acid (CAS 676629-90-6) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: (2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoic acid. InChIKey: FPMRFGHGLLFAJZ-MRVPVSSYSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | (2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoic acid |
| InChIKey | FPMRFGHGLLFAJZ-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](C(=O)O)C(C)(C)C=C |
Computed by PubChem (NCBI)