CAS 854250-89-8 appears in our catalog under these names: (R)-Boc-2-amino-3,3-dimethyl-pent-4-enoic acid, 95%, 2-(Boc-amino)-3,3-diMe-pent-4-enoic acid (R), Boc-3-Vinyl-D-Val-OH 97%, (R)-BOC-2-AMINO-3,3-DIMETHYL-PENT-4-ENOIC ACID, 98%, 98%, (R)-Boc-2-amino-3,3-dimethyl-pent-4-enoic acid, 98%. Offered by: Combi-blocks, Iris Biotech, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g.
(2R)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoic acid (CAS 854250-89-8) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: (2R)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoic acid. InChIKey: FPMRFGHGLLFAJZ-QMMMGPOBSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | (2R)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoic acid |
| InChIKey | FPMRFGHGLLFAJZ-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](C(=O)O)C(C)(C)C=C |
Computed by PubChem (NCBI)