CAS 82706-50-1 is the registry number for 2-((tert-Butoxycarbonyl)amino)-3,3-dimethylpent-4-enoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoic acid (CAS 82706-50-1) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: 3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoic acid. InChIKey: FPMRFGHGLLFAJZ-UHFFFAOYSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | 3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoic acid |
| InChIKey | FPMRFGHGLLFAJZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C(=O)O)C(C)(C)C=C |
Computed by PubChem (NCBI)