CAS 677302-44-2 appears in our catalog under these names: 1-(Phenylsulfonyl)-1H-pyrrolo[3,2-b]pyridine, 98%, 98%, 1-(PHENYLSULFONYL)-4-AZAINDOLE, 98%, 1-(Phenylsulfonyl)-1H-pyrrolo[3,2-b]pyridine, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-(benzenesulfonyl)pyrrolo[3,2-b]pyridine (CAS 677302-44-2) is a chemical compound with the molecular formula C13H10N2O2S and a molecular weight of 258.30 g/mol. IUPAC name: 1-(benzenesulfonyl)pyrrolo[3,2-b]pyridine. InChIKey: HGOGRVVSSAWHTO-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O2S |
|---|---|
| Molecular weight | 258.30 g/mol |
| IUPAC name | 1-(benzenesulfonyl)pyrrolo[3,2-b]pyridine |
| InChIKey | HGOGRVVSSAWHTO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)N2C=CC3=C2C=CC=N3 |
Computed by PubChem (NCBI)