CAS 677304-64-2 is the registry number for 6-Methoxy-benzo(d)isothiazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
6-methoxy-1,2-benzothiazole-3-carboxylic acid (CAS 677304-64-2) is a chemical compound with the molecular formula C9H7NO3S and a molecular weight of 209.22 g/mol. IUPAC name: 6-methoxy-1,2-benzothiazole-3-carboxylic acid. InChIKey: TVWVDWCIELUGGY-UHFFFAOYSA-N.
| Molecular formula | C9H7NO3S |
|---|---|
| Molecular weight | 209.22 g/mol |
| IUPAC name | 6-methoxy-1,2-benzothiazole-3-carboxylic acid |
| InChIKey | TVWVDWCIELUGGY-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(=NS2)C(=O)O |
Computed by PubChem (NCBI)