Products 677304-64-2

CAS 677304-64-2 is the registry number for 6-Methoxy-benzo(d)isothiazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

6-methoxy-1,2-benzothiazole-3-carboxylic acid (CAS 677304-64-2) is a chemical compound with the molecular formula C9H7NO3S and a molecular weight of 209.22 g/mol. IUPAC name: 6-methoxy-1,2-benzothiazole-3-carboxylic acid. InChIKey: TVWVDWCIELUGGY-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7NO3S
Molecular weight209.22 g/mol
IUPAC name6-methoxy-1,2-benzothiazole-3-carboxylic acid
InChIKeyTVWVDWCIELUGGY-UHFFFAOYSA-N
SMILESCOC1=CC2=C(C=C1)C(=NS2)C(=O)O

Computed by PubChem (NCBI)