CAS 678149-02-5 is the registry number for 3-((1E)-2-(4-Hydroxyphenyl)ethenyl)-5-(phenylmethoxy)-phenol. Offered by: TRC. Available pack sizes: 25mg.
3-[(E)-2-(4-hydroxyphenyl)ethenyl]-5-phenylmethoxyphenol (CAS 678149-02-5) is a chemical compound with the molecular formula C21H18O3 and a molecular weight of 318.4 g/mol. IUPAC name: 3-[(E)-2-(4-hydroxyphenyl)ethenyl]-5-phenylmethoxyphenol. InChIKey: DQRVEESLGDZHMJ-VOTSOKGWSA-N.
| Molecular formula | C21H18O3 |
|---|---|
| Molecular weight | 318.4 g/mol |
| IUPAC name | 3-[(E)-2-(4-hydroxyphenyl)ethenyl]-5-phenylmethoxyphenol |
| InChIKey | DQRVEESLGDZHMJ-VOTSOKGWSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=CC(=C2)O)/C=C/C3=CC=C(C=C3)O |
Computed by PubChem (NCBI)