Products 67823-48-7
CAS 67823-48-7 is the registry number for 2-[(5-methyl-2-nitro-phenoxy)methyl]oxirane, 97%. Offered by: Chemat. Available pack sizes: 1g, 5g.
2-[(5-methyl-2-nitrophenoxy)methyl]oxirane (CAS 67823-48-7) is a chemical compound with the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. IUPAC name: 2-[(5-methyl-2-nitrophenoxy)methyl]oxirane. InChIKey: APVPMIZSQOAPIX-UHFFFAOYSA-N.
| Molecular formula | C10H11NO4 |
|---|---|
| Molecular weight | 209.20 g/mol |
| IUPAC name | 2-[(5-methyl-2-nitrophenoxy)methyl]oxirane |
| InChIKey | APVPMIZSQOAPIX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)[N+](=O)[O-])OCC2CO2 |
Computed by PubChem (NCBI)