Products 678992-21-7

CAS 678992-21-7 is the registry number for 2-({((9H-Fluoren-9-yl)methoxy)carbonyl}amino)-2-phenylpropanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-phenylpropanoic acid (CAS 678992-21-7) is a chemical compound with the molecular formula C24H21NO4 and a molecular weight of 387.4 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-phenylpropanoic acid. InChIKey: BGAVVPDORCZLJU-UHFFFAOYSA-N.

Identity
Molecular formulaC24H21NO4
Molecular weight387.4 g/mol
IUPAC name2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-phenylpropanoic acid
InChIKeyBGAVVPDORCZLJU-UHFFFAOYSA-N
SMILESCC(C1=CC=CC=C1)(C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24

Computed by PubChem (NCBI)