CAS 881921-11-5 appears in our catalog under these names: (S)-2-(((9H-Fluoren-9-yl)methoxy)carbonylamino)-2-phenylpropanoic acid, 95%, (S)-2-(((9H-Fluoren-9-yl)methoxy)carbonylamino)-2-phenylpropanoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 0,5g, 50mg.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-phenylpropanoic acid (CAS 881921-11-5) is a chemical compound with the molecular formula C24H21NO4 and a molecular weight of 387.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-phenylpropanoic acid. InChIKey: BGAVVPDORCZLJU-DEOSSOPVSA-N.
| Molecular formula | C24H21NO4 |
|---|---|
| Molecular weight | 387.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-phenylpropanoic acid |
| InChIKey | BGAVVPDORCZLJU-DEOSSOPVSA-N |
| SMILES | C[C@](C1=CC=CC=C1)(C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)