CAS 6795-22-8 is the registry number for (-)-Dihydroaflatoxin D2. Offered by: TRC. Available pack sizes: 50mg.
(3aR,8bS)-6-methoxy-1,2,3a,8b-tetrahydrofuro[2,3-b][1]benzofuran-8-ol (CAS 6795-22-8) is a chemical compound with the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. IUPAC name: (3aR,8bS)-6-methoxy-1,2,3a,8b-tetrahydrofuro[2,3-b][1]benzofuran-8-ol. InChIKey: YNPOSBONXFRQDW-WRWORJQWSA-N.
| Molecular formula | C11H12O4 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | (3aR,8bS)-6-methoxy-1,2,3a,8b-tetrahydrofuro[2,3-b][1]benzofuran-8-ol |
| InChIKey | YNPOSBONXFRQDW-WRWORJQWSA-N |
| SMILES | COC1=CC(=C2[C@@H]3CCO[C@@H]3OC2=C1)O |
Computed by PubChem (NCBI)