Products 679835-69-9
CAS 679835-69-9 is the registry number for 2'-Amino-5'-methyl-[1,1':3',1''-terphenyl]-4,4''-dicarbaldehyde, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[2-amino-3-(4-formylphenyl)-5-methylphenyl]benzaldehyde (CAS 679835-69-9) is a chemical compound with the molecular formula C21H17NO2 and a molecular weight of 315.4 g/mol. IUPAC name: 4-[2-amino-3-(4-formylphenyl)-5-methylphenyl]benzaldehyde. InChIKey: UOKDRANBZBWJIF-UHFFFAOYSA-N.
| Molecular formula | C21H17NO2 |
|---|---|
| Molecular weight | 315.4 g/mol |
| IUPAC name | 4-[2-amino-3-(4-formylphenyl)-5-methylphenyl]benzaldehyde |
| InChIKey | UOKDRANBZBWJIF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C2=CC=C(C=C2)C=O)N)C3=CC=C(C=C3)C=O |
Computed by PubChem (NCBI)