CAS 1415473-88-9 is the registry number for N-(2-(4-Phenylbenzoyl)phenyl)acetamide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g, 25g.
N-[2-(4-phenylbenzoyl)phenyl]acetamide (CAS 1415473-88-9) is a chemical compound with the molecular formula C21H17NO2 and a molecular weight of 315.4 g/mol. IUPAC name: N-[2-(4-phenylbenzoyl)phenyl]acetamide. InChIKey: YUZSGPNOMYXIHA-UHFFFAOYSA-N.
| Molecular formula | C21H17NO2 |
|---|---|
| Molecular weight | 315.4 g/mol |
| IUPAC name | N-[2-(4-phenylbenzoyl)phenyl]acetamide |
| InChIKey | YUZSGPNOMYXIHA-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=CC=C1C(=O)C2=CC=C(C=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)