CAS 352534-92-0 is the registry number for (S)–4,5,5–Triphenyloxazolidin–2–one. Offered by: GLPBio. Available pack sizes: 1g, 250mg, 50mg.
(4S)-4,5,5-triphenyl-1,3-oxazolidin-2-one (CAS 352534-92-0) is a chemical compound with the molecular formula C21H17NO2 and a molecular weight of 315.4 g/mol. IUPAC name: (4S)-4,5,5-triphenyl-1,3-oxazolidin-2-one. InChIKey: QCWBJFYOEHCELV-IBGZPJMESA-N.
| Molecular formula | C21H17NO2 |
|---|---|
| Molecular weight | 315.4 g/mol |
| IUPAC name | (4S)-4,5,5-triphenyl-1,3-oxazolidin-2-one |
| InChIKey | QCWBJFYOEHCELV-IBGZPJMESA-N |
| SMILES | C1=CC=C(C=C1)[C@H]2C(OC(=O)N2)(C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)