Products 1862216-82-7
CAS 1862216-82-7 is the registry number for Ethyl 9-phenyl-9H-carbazole-3-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg.
Ethyl 9-phenylcarbazole-3-carboxylate (CAS 1862216-82-7) is a chemical compound with the molecular formula C21H17NO2 and a molecular weight of 315.4 g/mol. IUPAC name: ethyl 9-phenylcarbazole-3-carboxylate. InChIKey: XVFBWROPUQSQGD-UHFFFAOYSA-N.
| Molecular formula | C21H17NO2 |
|---|---|
| Molecular weight | 315.4 g/mol |
| IUPAC name | ethyl 9-phenylcarbazole-3-carboxylate |
| InChIKey | XVFBWROPUQSQGD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C=C1)N(C3=CC=CC=C32)C4=CC=CC=C4 |
Computed by PubChem (NCBI)