Products 22320-39-4

CAS 22320-39-4 is the registry number for 4-(Phenylmethylidene)-1,2,3,4-tetrahydroacridine-9-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

(4Z)-4-benzylidene-2,3-dihydro-1H-acridine-9-carboxylic acid (CAS 22320-39-4) is a chemical compound with the molecular formula C21H17NO2 and a molecular weight of 315.4 g/mol. IUPAC name: (4Z)-4-benzylidene-2,3-dihydro-1H-acridine-9-carboxylic acid. InChIKey: DNYHUHLGVWFVQQ-SQFISAMPSA-N.

Identity
Molecular formulaC21H17NO2
Molecular weight315.4 g/mol
IUPAC name(4Z)-4-benzylidene-2,3-dihydro-1H-acridine-9-carboxylic acid
InChIKeyDNYHUHLGVWFVQQ-SQFISAMPSA-N
SMILESC1C/C(=C/C2=CC=CC=C2)/C3=NC4=CC=CC=C4C(=C3C1)C(=O)O

Computed by PubChem (NCBI)