CAS 156481-74-2 appears in our catalog under these names: (R)–4,5,5–Triphenyl–2–oxazolidinone, (R)-4,5,5-Triphenyloxazolidin-2-one, 95%, (4R)-4,5,5-triphenyl-1,3-oxazolidin-2-one, ≥95%, ≥95%. Offered by: GLPBio, AmBeed, Fluorochem, Chemat. Available pack sizes: 1g, 250mg.
(4R)-4,5,5-triphenyl-1,3-oxazolidin-2-one (CAS 156481-74-2) is a chemical compound with the molecular formula C21H17NO2 and a molecular weight of 315.4 g/mol. IUPAC name: (4R)-4,5,5-triphenyl-1,3-oxazolidin-2-one. InChIKey: QCWBJFYOEHCELV-LJQANCHMSA-N.
| Molecular formula | C21H17NO2 |
|---|---|
| Molecular weight | 315.4 g/mol |
| IUPAC name | (4R)-4,5,5-triphenyl-1,3-oxazolidin-2-one |
| InChIKey | QCWBJFYOEHCELV-LJQANCHMSA-N |
| SMILES | C1=CC=C(C=C1)[C@@H]2C(OC(=O)N2)(C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)