Products 681004-55-7
CAS 681004-55-7 is the registry number for 2-bromo-5-(3-methoxyphenyl)oxazole. Offered by: Chemat. Available pack sizes: 1g.
2-bromo-5-(3-methoxyphenyl)-1,3-oxazole (CAS 681004-55-7) is a chemical compound with the molecular formula C10H8BrNO2 and a molecular weight of 254.08 g/mol. IUPAC name: 2-bromo-5-(3-methoxyphenyl)-1,3-oxazole. InChIKey: PIFRXVNEVVWYNQ-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO2 |
|---|---|
| Molecular weight | 254.08 g/mol |
| IUPAC name | 2-bromo-5-(3-methoxyphenyl)-1,3-oxazole |
| InChIKey | PIFRXVNEVVWYNQ-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C2=CN=C(O2)Br |
Computed by PubChem (NCBI)