CAS 68133-98-2 is the registry number for 4–Nitro–N–propylbenzylamine hydrochloride. Offered by: GLPBio. Available pack sizes: 1g.
N-[(4-nitrophenyl)methyl]propan-1-amine;hydrochloride (CAS 68133-98-2) is a chemical compound with the molecular formula C10H15ClN2O2 and a molecular weight of 230.69 g/mol. IUPAC name: N-[(4-nitrophenyl)methyl]propan-1-amine;hydrochloride. InChIKey: LWISLZIFEARHJI-UHFFFAOYSA-N.
| Molecular formula | C10H15ClN2O2 |
|---|---|
| Molecular weight | 230.69 g/mol |
| IUPAC name | N-[(4-nitrophenyl)methyl]propan-1-amine;hydrochloride |
| InChIKey | LWISLZIFEARHJI-UHFFFAOYSA-N |
| SMILES | CCCNCC1=CC=C(C=C1)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)