Products 68194-06-9

CAS 68194-06-9 is the registry number for PCB 102, ROTI®Star, 5 mg, glass. Offered by: Roth. Available pack sizes: 5mg.

Structural formula: {0} (CAS {1})

1,2,4-trichloro-5-(2,6-dichlorophenyl)benzene (CAS 68194-06-9) is a chemical compound with the molecular formula C12H5Cl5 and a molecular weight of 326.4 g/mol. IUPAC name: 1,2,4-trichloro-5-(2,6-dichlorophenyl)benzene. InChIKey: BWWVXHRLMPBDCK-UHFFFAOYSA-N.

Identity
Molecular formulaC12H5Cl5
Molecular weight326.4 g/mol
IUPAC name1,2,4-trichloro-5-(2,6-dichlorophenyl)benzene
InChIKeyBWWVXHRLMPBDCK-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1)Cl)C2=CC(=C(C=C2Cl)Cl)Cl)Cl

Computed by PubChem (NCBI)