Products 68208-16-2

CAS 68208-16-2 appears in our catalog under these names: beta-Amino-2-methylbenzenepropanoic Acid, 3-Amino-3-(2-methylphenyl)propanoic acid, 95%, 3–Amino–3–(o–tolyl)propanoic acid, 3-Amino-3-(o-tolyl)propanoic acid, 97%, 97%, 3-Amino-3-(o-tolyl)propanoic acid, 97%. Offered by: TRC, Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 2,5g, 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

3-amino-3-(2-methylphenyl)propanoic acid (CAS 68208-16-2) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: 3-amino-3-(2-methylphenyl)propanoic acid. InChIKey: GORGZFRGYDIRJA-UHFFFAOYSA-N.

Identity
Molecular formulaC10H13NO2
Molecular weight179.22 g/mol
IUPAC name3-amino-3-(2-methylphenyl)propanoic acid
InChIKeyGORGZFRGYDIRJA-UHFFFAOYSA-N
SMILESCC1=CC=CC=C1C(CC(=O)O)N

Computed by PubChem (NCBI)