CAS 736131-48-9 appears in our catalog under these names: H-β-Phe(2-Me)-OH 98%, (S)-3-Amino-3-(2-methylphenyl)propionic acid, 98%, 98%, (S)-3-Amino-3-(2-methylphenyl)propionic acid, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g.
(3S)-3-amino-3-(2-methylphenyl)propanoic acid (CAS 736131-48-9) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: (3S)-3-amino-3-(2-methylphenyl)propanoic acid. InChIKey: GORGZFRGYDIRJA-VIFPVBQESA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | (3S)-3-amino-3-(2-methylphenyl)propanoic acid |
| InChIKey | GORGZFRGYDIRJA-VIFPVBQESA-N |
| SMILES | CC1=CC=CC=C1[C@H](CC(=O)O)N |
Computed by PubChem (NCBI)