CAS 752198-38-2 appears in our catalog under these names: (R)-3-Amino-3-(o-tolyl)propanoic acid, 95%, (R)–3–Amino–3–(o–tolyl)propanoic acid, (R)-3-Amino-3-(o-tolyl)propanoic acid, ≥95%, ≥95%, (R)-3-Amino-3-(o-tolyl)propanoic acid, 97%. Offered by: AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 50mg.
(3R)-3-amino-3-(2-methylphenyl)propanoic acid (CAS 752198-38-2) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: (3R)-3-amino-3-(2-methylphenyl)propanoic acid. InChIKey: GORGZFRGYDIRJA-SECBINFHSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | (3R)-3-amino-3-(2-methylphenyl)propanoic acid |
| InChIKey | GORGZFRGYDIRJA-SECBINFHSA-N |
| SMILES | CC1=CC=CC=C1[C@@H](CC(=O)O)N |
Computed by PubChem (NCBI)