Products 68245-17-0
CAS 68245-17-0 is the registry number for Enaminomycin B. Offered by: MedChemExpress. Available pack sizes: Get quote.
(1S,5S,6R)-2,5-dihydroxy-4-imino-5-(2-oxopropyl)-7-oxabicyclo[4.1.0]hept-2-ene-3-carboxylic acid (CAS 68245-17-0) is a chemical compound with the molecular formula C10H11NO6 and a molecular weight of 241.20 g/mol. IUPAC name: (1S,5S,6R)-2,5-dihydroxy-4-imino-5-(2-oxopropyl)-7-oxabicyclo[4.1.0]hept-2-ene-3-carboxylic acid. InChIKey: VKKYJXLQEGBUNY-YNEQXMIYSA-N.
| Molecular formula | C10H11NO6 |
|---|---|
| Molecular weight | 241.20 g/mol |
| IUPAC name | (1S,5S,6R)-2,5-dihydroxy-4-imino-5-(2-oxopropyl)-7-oxabicyclo[4.1.0]hept-2-ene-3-carboxylic acid |
| InChIKey | VKKYJXLQEGBUNY-YNEQXMIYSA-N |
| SMILES | CC(=O)C[C@]1([C@H]2[C@H](O2)C(=C(C1=N)C(=O)O)O)O |
Computed by PubChem (NCBI)
Synonyms:
Enaminomycin B, orb3024289