Products 682802-82-0

CAS 682802-82-0 appears in our catalog under these names: 2-(6-(Benzyloxy)-1H-indol-3-yl)acetic acid, 98+%, 6-Benzyloxyindole-3-acetic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 100mg, 250mg.

Structural formula: {0} (CAS {1})

2-(6-phenylmethoxy-1H-indol-3-yl)acetic acid (CAS 682802-82-0) is a chemical compound with the molecular formula C17H15NO3 and a molecular weight of 281.30 g/mol. IUPAC name: 2-(6-phenylmethoxy-1H-indol-3-yl)acetic acid. InChIKey: PHNNDRRSUHPAFS-UHFFFAOYSA-N.

Identity
Molecular formulaC17H15NO3
Molecular weight281.30 g/mol
IUPAC name2-(6-phenylmethoxy-1H-indol-3-yl)acetic acid
InChIKeyPHNNDRRSUHPAFS-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)COC2=CC3=C(C=C2)C(=CN3)CC(=O)O

Computed by PubChem (NCBI)