Products 682803-15-2
CAS 682803-15-2 appears in our catalog under these names: 3–Amino–2–(3，4–dichlorobenzyl)propanoic Acid, 3-AMINO-2-(3,4-DICHLOROBENZYL)PROPANOIC ACID, 3-Amino-2-(3,4-dichlorobenzyl)propanoic acid, 95%, 3-Amino-2-(3,4-dichlorobenzyl)propanoic acid 95%, 2-Aminomethyl-3-(3,4-dichloro-phenyl)-propionic acid, 95%. Offered by: GLPBio, Fluorochem, AmBeed, Combi-blocks, Chemat. Available pack sizes: 1g, 250mg, 100mg.
2-(aminomethyl)-3-(3,4-dichlorophenyl)propanoic acid (CAS 682803-15-2) is a chemical compound with the molecular formula C10H11Cl2NO2 and a molecular weight of 248.10 g/mol. IUPAC name: 2-(aminomethyl)-3-(3,4-dichlorophenyl)propanoic acid. InChIKey: OWUCQTYNFQLYOY-UHFFFAOYSA-N.
| Molecular formula | C10H11Cl2NO2 |
|---|---|
| Molecular weight | 248.10 g/mol |
| IUPAC name | 2-(aminomethyl)-3-(3,4-dichlorophenyl)propanoic acid |
| InChIKey | OWUCQTYNFQLYOY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CC(CN)C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)