Products 1218320-00-3
CAS 1218320-00-3 appears in our catalog under these names: 2-(3,5-Dichlorophenyl)-2-(dimethylamino)acetic acid, 95%, 2-(3,5-Dichlorophenyl)-2-(dimethylamino)acetic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 250mg, 1g, 50mg, 0,5g.
2-(3,5-dichlorophenyl)-2-(dimethylamino)acetic acid (CAS 1218320-00-3) is a chemical compound with the molecular formula C10H11Cl2NO2 and a molecular weight of 248.10 g/mol. IUPAC name: 2-(3,5-dichlorophenyl)-2-(dimethylamino)acetic acid. InChIKey: FBZPIHFBJZHLPX-UHFFFAOYSA-N.
| Molecular formula | C10H11Cl2NO2 |
|---|---|
| Molecular weight | 248.10 g/mol |
| IUPAC name | 2-(3,5-dichlorophenyl)-2-(dimethylamino)acetic acid |
| InChIKey | FBZPIHFBJZHLPX-UHFFFAOYSA-N |
| SMILES | CN(C)C(C1=CC(=CC(=C1)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)