CAS 1258845-93-0 appears in our catalog under these names: (4-Amino-3,5-dichloro-phenyl)-acetic acid ethyl ester, 95%, Ethyl 2-(4-amino-3,5-dichlorophenyl)acetate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
Ethyl 2-(4-amino-3,5-dichlorophenyl)acetate (CAS 1258845-93-0) is a chemical compound with the molecular formula C10H11Cl2NO2 and a molecular weight of 248.10 g/mol. IUPAC name: ethyl 2-(4-amino-3,5-dichlorophenyl)acetate. InChIKey: MIOUXSFLVHDQPC-UHFFFAOYSA-N.
| Molecular formula | C10H11Cl2NO2 |
|---|---|
| Molecular weight | 248.10 g/mol |
| IUPAC name | ethyl 2-(4-amino-3,5-dichlorophenyl)acetate |
| InChIKey | MIOUXSFLVHDQPC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1=CC(=C(C(=C1)Cl)N)Cl |
Computed by PubChem (NCBI)