CAS 75308-46-2 appears in our catalog under these names: tert-Butyl 2,6-dichloroisonicotinate, 97%, tert–Butyl 2,6–Dichloropyridine–4–carboxylate, tert-Butyl 2,6-Dichloroisonicotinate, >98.0%(GC), tert-Butyl 2,6-dichloroisonicotinate 97%, Tert-Butyl 2,6-Dichloroisonicotinate, 97%, 97%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 10g, 5g, 25g, 1g, 100g, 250mg.
Tert-butyl 2,6-dichloropyridine-4-carboxylate (CAS 75308-46-2) is a chemical compound with the molecular formula C10H11Cl2NO2 and a molecular weight of 248.10 g/mol. IUPAC name: tert-butyl 2,6-dichloropyridine-4-carboxylate. InChIKey: PLRVIRHWKQKSAK-UHFFFAOYSA-N.
| Molecular formula | C10H11Cl2NO2 |
|---|---|
| Molecular weight | 248.10 g/mol |
| IUPAC name | tert-butyl 2,6-dichloropyridine-4-carboxylate |
| InChIKey | PLRVIRHWKQKSAK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC(=NC(=C1)Cl)Cl |
Computed by PubChem (NCBI)