CAS 346726-62-3 appears in our catalog under these names: 3-Chloro-n-(5-chloro-2-methoxyphenyl)propanamide, 95%, 3-Chloro-N-(5-chloro-2-methoxyphenyl)propanamide, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
3-chloro-N-(5-chloro-2-methoxyphenyl)propanamide (CAS 346726-62-3) is a chemical compound with the molecular formula C10H11Cl2NO2 and a molecular weight of 248.10 g/mol. IUPAC name: 3-chloro-N-(5-chloro-2-methoxyphenyl)propanamide. InChIKey: DXHGFUVWTWXSFB-UHFFFAOYSA-N.
| Molecular formula | C10H11Cl2NO2 |
|---|---|
| Molecular weight | 248.10 g/mol |
| IUPAC name | 3-chloro-N-(5-chloro-2-methoxyphenyl)propanamide |
| InChIKey | DXHGFUVWTWXSFB-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)Cl)NC(=O)CCCl |
Computed by PubChem (NCBI)