Products 682804-04-2
CAS 682804-04-2 appears in our catalog under these names: 3-Amino-3-(2,3-difluorophenyl)propanoic acid, 97%, 97%, 3-Amino-3-(2,3-difluorophenyl)propanoic acid, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
3-amino-3-(2,3-difluorophenyl)propanoic acid (CAS 682804-04-2) is a chemical compound with the molecular formula C9H9F2NO2 and a molecular weight of 201.17 g/mol. IUPAC name: 3-amino-3-(2,3-difluorophenyl)propanoic acid. InChIKey: PDSVPPFKLOHCFR-UHFFFAOYSA-N.
| Molecular formula | C9H9F2NO2 |
|---|---|
| Molecular weight | 201.17 g/mol |
| IUPAC name | 3-amino-3-(2,3-difluorophenyl)propanoic acid |
| InChIKey | PDSVPPFKLOHCFR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)F)C(CC(=O)O)N |
Computed by PubChem (NCBI)