CAS 682805-00-1 is the registry number for 2–Fluoro–4–Methoxycinnamic Acid. Offered by: GLPBio. Available pack sizes: 100mg.
(E)-3-(2-fluoro-4-methoxyphenyl)prop-2-enoic acid (CAS 682805-00-1) is a chemical compound with the molecular formula C10H9FO3 and a molecular weight of 196.17 g/mol. IUPAC name: (E)-3-(2-fluoro-4-methoxyphenyl)prop-2-enoic acid. InChIKey: KDSPBZWHHBVYFN-HWKANZROSA-N.
| Molecular formula | C10H9FO3 |
|---|---|
| Molecular weight | 196.17 g/mol |
| IUPAC name | (E)-3-(2-fluoro-4-methoxyphenyl)prop-2-enoic acid |
| InChIKey | KDSPBZWHHBVYFN-HWKANZROSA-N |
| SMILES | COC1=CC(=C(C=C1)/C=C/C(=O)O)F |
Computed by PubChem (NCBI)