CAS 68287-25-2 is the registry number for (Z)-3-((2-Hydroxypropyl)imino)-2,3-dihydrobenzo[d]isothiazole 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propan-2-ol (CAS 68287-25-2) is a chemical compound with the molecular formula C10H12N2O3S and a molecular weight of 240.28 g/mol. IUPAC name: 1-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propan-2-ol. InChIKey: PRGPSERYXJXVIZ-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O3S |
|---|---|
| Molecular weight | 240.28 g/mol |
| IUPAC name | 1-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propan-2-ol |
| InChIKey | PRGPSERYXJXVIZ-UHFFFAOYSA-N |
| SMILES | CC(CN=C1C2=CC=CC=C2S(=O)(=O)N1)O |
Computed by PubChem (NCBI)