Products 683278-67-3
CAS 683278-67-3 is the registry number for 5,8-Dihydroxy-3',4',6,7-tetramethoxyflavone, 97.75%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 1 mg, 5 mg.
2-(3,4-dimethoxyphenyl)-5,8-dihydroxy-6,7-dimethoxychromen-4-one (CAS 683278-67-3) is a chemical compound with the molecular formula C19H18O8 and a molecular weight of 374.3 g/mol. IUPAC name: 2-(3,4-dimethoxyphenyl)-5,8-dihydroxy-6,7-dimethoxychromen-4-one. InChIKey: YMZYQFDBQUZFJS-UHFFFAOYSA-N.
| Molecular formula | C19H18O8 |
|---|---|
| Molecular weight | 374.3 g/mol |
| IUPAC name | 2-(3,4-dimethoxyphenyl)-5,8-dihydroxy-6,7-dimethoxychromen-4-one |
| InChIKey | YMZYQFDBQUZFJS-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=CC(=O)C3=C(C(=C(C(=C3O2)O)OC)OC)O)OC |
Computed by PubChem (NCBI)