Products 68399-17-7
CAS 68399-17-7 appears in our catalog under these names: (2R，3S)–Pterosin C, (2R,3S)-Pterosin C. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, Get quote.
(2R,3S)-3-hydroxy-6-(2-hydroxyethyl)-2,5,7-trimethyl-2,3-dihydroinden-1-one (CAS 68399-17-7) is a chemical compound with the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. IUPAC name: (2R,3S)-3-hydroxy-6-(2-hydroxyethyl)-2,5,7-trimethyl-2,3-dihydroinden-1-one. InChIKey: QQPCNRKHGFIVLH-RNCFNFMXSA-N.
| Molecular formula | C14H18O3 |
|---|---|
| Molecular weight | 234.29 g/mol |
| IUPAC name | (2R,3S)-3-hydroxy-6-(2-hydroxyethyl)-2,5,7-trimethyl-2,3-dihydroinden-1-one |
| InChIKey | QQPCNRKHGFIVLH-RNCFNFMXSA-N |
| SMILES | C[C@@H]1[C@@H](C2=C(C1=O)C(=C(C(=C2)C)CCO)C)O |
Computed by PubChem (NCBI)
Synonyms:
(2R,3S)-Pterosin C, orb1992225