Products 685123-47-1
CAS 685123-47-1 is the registry number for (5-(4-Chlorophenyl)-1,2,4-oxadiazol-3-yl)methanol. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
[5-(4-chlorophenyl)-1,2,4-oxadiazol-3-yl]methanol (CAS 685123-47-1) is a chemical compound with the molecular formula C9H7ClN2O2 and a molecular weight of 210.62 g/mol. IUPAC name: [5-(4-chlorophenyl)-1,2,4-oxadiazol-3-yl]methanol. InChIKey: PLRDZVBEOOYILK-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O2 |
|---|---|
| Molecular weight | 210.62 g/mol |
| IUPAC name | [5-(4-chlorophenyl)-1,2,4-oxadiazol-3-yl]methanol |
| InChIKey | PLRDZVBEOOYILK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC(=NO2)CO)Cl |
Computed by PubChem (NCBI)