CAS 68579-35-1 appears in our catalog under these names: N-phenylpyridiniumchloride, 95%, Indocyanine Green Impurity 4. Offered by: Chemat Brand. Available pack sizes: on request.
1-phenylpyridin-1-ium chloride (CAS 68579-35-1) is a chemical compound with the molecular formula C11H10ClN and a molecular weight of 191.65 g/mol. IUPAC name: 1-phenylpyridin-1-ium chloride. InChIKey: OIVXRBLKXPTIMU-UHFFFAOYSA-M.
| Molecular formula | C11H10ClN |
|---|---|
| Molecular weight | 191.65 g/mol |
| IUPAC name | 1-phenylpyridin-1-ium chloride |
| InChIKey | OIVXRBLKXPTIMU-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)[N+]2=CC=CC=C2.[Cl-] |
Computed by PubChem (NCBI)