Products 68586-19-6

CAS 68586-19-6 is the registry number for 2,2-Bis(1-cyclopenten-1-yloxy)ethyl methacrylate. Offered by: Biosynth. Available pack sizes: 2kg, 5kg.

Structural formula: {0} (CAS {1})

2,2-di(cyclopenten-1-yloxy)ethyl 2-methylprop-2-enoate (CAS 68586-19-6) is a chemical compound with the molecular formula C16H22O4 and a molecular weight of 278.34 g/mol. IUPAC name: 2,2-di(cyclopenten-1-yloxy)ethyl 2-methylprop-2-enoate. InChIKey: JMIZWXDKTUGEES-UHFFFAOYSA-N.

Identity
Molecular formulaC16H22O4
Molecular weight278.34 g/mol
IUPAC name2,2-di(cyclopenten-1-yloxy)ethyl 2-methylprop-2-enoate
InChIKeyJMIZWXDKTUGEES-UHFFFAOYSA-N
SMILESCC(=C)C(=O)OCC(OC1=CCCC1)OC2=CCCC2

Computed by PubChem (NCBI)