Products 68652-09-5
CAS 68652-09-5 appears in our catalog under these names: Octyl-agarose, contain 20% ethanol solution, 25 g, Octyl-agarose, contain 20% ethanol solution, 50 g, Octyl-agarose, contain 20% ethanol solution, 100 g, Octyl-agarose, contain 20% ethanol solution, 250 g, Octyl-agarose, contain 20% ethanol solution, 500 g. Offered by: Roth, Sigma-Aldrich. Available pack sizes: 25g, 50g, 100g, 250g, 500g, 50ML.
4-cyano-2-[(2-methoxy-2-phenylacetyl)amino]butanoic acid (CAS 68652-09-5) is a chemical compound with the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. IUPAC name: 4-cyano-2-[(2-methoxy-2-phenylacetyl)amino]butanoic acid. InChIKey: MNLPNEJUCROKSW-UHFFFAOYSA-N.
| Molecular formula | C14H16N2O4 |
|---|---|
| Molecular weight | 276.29 g/mol |
| IUPAC name | 4-cyano-2-[(2-methoxy-2-phenylacetyl)amino]butanoic acid |
| InChIKey | MNLPNEJUCROKSW-UHFFFAOYSA-N |
| SMILES | COC(C1=CC=CC=C1)C(=O)NC(CCC#N)C(=O)O |
Computed by PubChem (NCBI)