CAS 68939-22-0 appears in our catalog under these names: Astragalus Metabolite 9, 7-Hydroxy-5-methoxy-3-(4-methoxyphenyl)-4H-1-benzopyran-4-one, 95%+, 95%+. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg.
7-hydroxy-5-methoxy-3-(4-methoxyphenyl)chromen-4-one (CAS 68939-22-0) is a chemical compound with the molecular formula C17H14O5 and a molecular weight of 298.29 g/mol. IUPAC name: 7-hydroxy-5-methoxy-3-(4-methoxyphenyl)chromen-4-one. InChIKey: JQQULYXWXRNRAX-UHFFFAOYSA-N.
| Molecular formula | C17H14O5 |
|---|---|
| Molecular weight | 298.29 g/mol |
| IUPAC name | 7-hydroxy-5-methoxy-3-(4-methoxyphenyl)chromen-4-one |
| InChIKey | JQQULYXWXRNRAX-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=COC3=C(C2=O)C(=CC(=C3)O)OC |
Computed by PubChem (NCBI)