CAS 690642-33-2 is the registry number for 2-(Chloromethyl)-5,7-dimethylimidazo(1,2-a)pyrimidine. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-(chloromethyl)-5,7-dimethylimidazo[1,2-a]pyrimidine (CAS 690642-33-2) is a chemical compound with the molecular formula C9H10ClN3 and a molecular weight of 195.65 g/mol. IUPAC name: 2-(chloromethyl)-5,7-dimethylimidazo[1,2-a]pyrimidine. InChIKey: CMDAULOGOZCZQT-UHFFFAOYSA-N.
| Molecular formula | C9H10ClN3 |
|---|---|
| Molecular weight | 195.65 g/mol |
| IUPAC name | 2-(chloromethyl)-5,7-dimethylimidazo[1,2-a]pyrimidine |
| InChIKey | CMDAULOGOZCZQT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=NC(=CN12)CCl)C |
Computed by PubChem (NCBI)