CAS 69113-60-6 appears in our catalog under these names: L-Phenylalanine-d7, >95% (HPLC), L-Phenylalanine-d7, 99.90%. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 25mg, 5mg, 5 mg, 1 mg.
(2S)-2-amino-3,3-dideuterio-3-(2,3,4,5,6-pentadeuteriophenyl)propanoic acid (CAS 69113-60-6) is a chemical compound with the molecular formula C9H11NO2 and a molecular weight of 172.23 g/mol. IUPAC name: (2S)-2-amino-3,3-dideuterio-3-(2,3,4,5,6-pentadeuteriophenyl)propanoic acid. InChIKey: COLNVLDHVKWLRT-RKWKZIRYSA-N.
| Molecular formula | C9H11NO2 |
|---|---|
| Molecular weight | 172.23 g/mol |
| IUPAC name | (2S)-2-amino-3,3-dideuterio-3-(2,3,4,5,6-pentadeuteriophenyl)propanoic acid |
| InChIKey | COLNVLDHVKWLRT-RKWKZIRYSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C([2H])([2H])[C@@H](C(=O)O)N)[2H])[2H] |
Computed by PubChem (NCBI)